C26H35Cl2NO6 — CID 171352048
[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2-[bis(2-chloroethyl)amino]benzoate (PubChem CID 171352048) has the molecular formula C26H35Cl2NO6 and a molecular weight of 528.47 g/mol. Its IUPAC name is [(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2-[bis(2-chloroethyl)amino]benzoate.
| Compound Name | [(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2-[bis(2-chloroethyl)amino]benzoate |
|---|---|
| PubChem CID | 171352048 |
| Molecular Formula | C26H35Cl2NO6 |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | [(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2-[bis(2-chloroethyl)amino]benzoate |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(OC(=O)c3ccccc3N(CCCl)CCCl)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C26H35Cl2NO6/c1-16-8-9-20-17(2)23(32-24-26(20)19(16)10-11-25(3,33-24)34-35-26)31-22(30)18-6-4-5-7-21(18)29(14-12-27)15-13-28/h4-7,16-17,19-20,23-24H,8-15H2,1-3H3/t16-,17-,19+,20+,23?,24-,25-,26-/m1/s1 |
| InChIKey | AZZLPCVVCDVRAR-NUXBEHBYSA-N |
| XLogP | 5.34 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|