C26H35Cl2NO6 — CID 171356227
[(1R,4S,5R,8S,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl 2-[bis(2-chloroethyl)amino]benzoate (PubChem CID 171356227) has the molecular formula C26H35Cl2NO6 and a molecular weight of 528.47 g/mol. Its IUPAC name is [(1R,4S,5R,8S,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl 2-[bis(2-chloroethyl)amino]benzoate.
| Compound Name | [(1R,4S,5R,8S,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl 2-[bis(2-chloroethyl)amino]benzoate |
|---|---|
| PubChem CID | 171356227 |
| Molecular Formula | C26H35Cl2NO6 |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | [(1R,4S,5R,8S,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl 2-[bis(2-chloroethyl)amino]benzoate |
| SMILES | C[C@@H]1CC[C@@H]2[C@]34OO[C@](C)(CC[C@@H]13)O[C@H]4O[C@]2(C)COC(=O)c1ccccc1N(CCCl)CCCl |
| InChI | InChI=1S/C26H35Cl2NO6/c1-17-8-9-21-24(2,32-23-26(21)19(17)10-11-25(3,33-23)34-35-26)16-31-22(30)18-6-4-5-7-20(18)29(14-12-27)15-13-28/h4-7,17,19,21,23H,8-16H2,1-3H3/t17-,19+,21+,23-,24-,25-,26-/m1/s1 |
| InChIKey | VQMLFDYHOSSHEC-FGKHKROTSA-N |
| XLogP | 5.13 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|