C31H44Cl2N2O7 — CID 73389561
methyl (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[2-[(5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetyl]amino]propanoate (PubChem CID 73389561) has the molecular formula C31H44Cl2N2O7 and a molecular weight of 627.61 g/mol. Its IUPAC name is methyl (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[2-[(5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetyl]amino]propanoate.
| Compound Name | methyl (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[2-[(5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 73389561 |
| Molecular Formula | C31H44Cl2N2O7 |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | methyl (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[2-[(5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)C[C@H]1O[C@@H]2OC3(C)CCC4[C@H](C)CC[C@@H]([C@H]1C)C42OO3 |
| InChI | InChI=1S/C31H44Cl2N2O7/c1-19-5-10-24-20(2)26(39-29-31(24)23(19)11-12-30(3,40-29)41-42-31)18-27(36)34-25(28(37)38-4)17-21-6-8-22(9-7-21)35(15-13-32)16-14-33/h6-9,19-20,23-26,29H,5,10-18H2,1-4H3,(H,34,36)/t19-,20-,23?,24+,25+,26-,29-,30?,31?/m1/s1 |
| InChIKey | VSSRIEIKYYIERU-NFNFPCALSA-N |
| XLogP | 4.81 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|