C30H41NO10 — CID 131664619
[(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-oxobutanoate (PubChem CID 131664619) has the molecular formula C30H41NO10 and a molecular weight of 575.66 g/mol. Its IUPAC name is [(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-oxobutanoate.
| Compound Name | [(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 131664619 |
| Molecular Formula | C30H41NO10 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | [(1R,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)NC(=O)CCC(=O)O[C@@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CCC([C@H]1C)C24OO3 |
| InChI | InChI=1S/C30H41NO10/c1-5-36-26(35)23(16-19-7-9-20(32)10-8-19)31-24(33)12-13-25(34)37-27-18(3)22-11-6-17(2)21-14-15-29(4)39-28(38-27)30(21,22)41-40-29/h7-10,17-18,21-23,27-28,32H,5-6,11-16H2,1-4H3,(H,31,33)/t17-,18-,21+,22?,23?,27-,28-,29-,30?/m1/s1 |
| InChIKey | QBYCKOJRNDGYMX-SQRCKPHOSA-N |
| XLogP | 3.51 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|