C36H52N2O11 — CID 73256340
(1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl) 4-[[1-[[1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-oxobutanoate (PubChem CID 73256340) has the molecular formula C36H52N2O11 and a molecular weight of 688.82 g/mol. Its IUPAC name is (1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl) 4-[[1-[[1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-oxobutanoate.
| Compound Name | (1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl) 4-[[1-[[1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 73256340 |
| Molecular Formula | C36H52N2O11 |
| Molecular Weight | 688.82 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | (1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl) 4-[[1-[[1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CC(C)C)NC(=O)CCC(=O)OC1OC2OC3(C)CCC4C(C)CCC(C1C)C24OO3 |
| InChI | InChI=1S/C36H52N2O11/c1-7-44-32(43)28(19-23-9-11-24(39)12-10-23)38-31(42)27(18-20(2)3)37-29(40)14-15-30(41)45-33-22(5)26-13-8-21(4)25-16-17-35(6)47-34(46-33)36(25,26)49-48-35/h9-12,20-22,25-28,33-34,39H,7-8,13-19H2,1-6H3,(H,37,40)(H,38,42) |
| InChIKey | CABHISDNAQUMTE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 167.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|