C21H28O7S — CID 73348184
[(1S,5R,8S,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl benzenesulfonate (PubChem CID 73348184) has the molecular formula C21H28O7S and a molecular weight of 424.52 g/mol. Its IUPAC name is [(1S,5R,8S,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl benzenesulfonate.
| Compound Name | [(1S,5R,8S,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl benzenesulfonate |
|---|---|
| PubChem CID | 73348184 |
| Molecular Formula | C21H28O7S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [(1S,5R,8S,9S,11R,12R)-1,5,9-trimethyl-10,13,14,15-tetraoxatetracyclo[9.3.1.04,12.08,12]pentadecan-9-yl]methyl benzenesulfonate |
| SMILES | C[C@@H]1CC[C@@H]2[C@]34OO[C@@](C)(CCC13)O[C@H]4O[C@]2(C)COS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H28O7S/c1-14-9-10-17-19(2,13-24-29(22,23)15-7-5-4-6-8-15)25-18-21(17)16(14)11-12-20(3,26-18)27-28-21/h4-8,14,16-18H,9-13H2,1-3H3/t14-,16?,17+,18-,19-,20+,21-/m1/s1 |
| InChIKey | MYWARXURNXBVAR-BXLKAVRNSA-N |
| XLogP | 3.40 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|