C24H30O8 — CID 125113605
[(1R,4R,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2-acetyloxybenzoate (PubChem CID 125113605) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is [(1R,4R,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2-acetyloxybenzoate.
| Compound Name | [(1R,4R,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 125113605 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(1R,4R,5R,8R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)O[C@@H]1O[C@@H]2O[C@@]3(C)CC[C@@H]4[C@H](C)CC[C@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C24H30O8/c1-13-9-10-18-14(2)21(28-20(26)16-7-5-6-8-19(16)27-15(3)25)29-22-24(18)17(13)11-12-23(4,30-22)31-32-24/h5-8,13-14,17-18,21-22H,9-12H2,1-4H3/t13-,14-,17-,18-,21-,22-,23-,24-/m1/s1 |
| InChIKey | VFWOCCJCKGNRAZ-IKMICNGVSA-N |
| XLogP | 3.98 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|