C20H25BrO7 — CID 124912036
[(1R,4R,5R,8R,9S,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 5-bromofuran-2-carboxylate (PubChem CID 124912036) has the molecular formula C20H25BrO7 and a molecular weight of 457.32 g/mol. Its IUPAC name is [(1R,4R,5R,8R,9S,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 5-bromofuran-2-carboxylate.
| Compound Name | [(1R,4R,5R,8R,9S,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 124912036 |
| Molecular Formula | C20H25BrO7 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [(1R,4R,5R,8R,9S,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 5-bromofuran-2-carboxylate |
| SMILES | C[C@@H]1[C@H](OC(=O)c2ccc(Br)o2)O[C@@H]2O[C@@]3(C)CC[C@@H]4[C@H](C)CC[C@H]1[C@@]24OO3 |
| InChI | InChI=1S/C20H25BrO7/c1-10-4-5-13-11(2)17(24-16(22)14-6-7-15(21)23-14)25-18-20(13)12(10)8-9-19(3,26-18)27-28-20/h6-7,10-13,17-18H,4-5,8-9H2,1-3H3/t10-,11+,12-,13-,17-,18-,19-,20-/m1/s1 |
| InChIKey | YRZPXAHVFRPJRP-LXJSLFJKSA-N |
| XLogP | 4.41 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|