C32H39FN2O6 — CID 72944494
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]ethanone (PubChem CID 72944494) has the molecular formula C32H39FN2O6 and a molecular weight of 566.67 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]ethanone.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]ethanone |
|---|---|
| PubChem CID | 72944494 |
| Molecular Formula | C32H39FN2O6 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[4-[[(1S,3R,5S,6R,10R,12R)-1,6,10-trimethyl-2,4,13,14-tetraoxatetracyclo[9.3.1.03,12.07,12]pentadecan-5-yl]oxy]phenyl]ethanone |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](Oc3ccc(CC(=O)N4CCN(c5ccc(F)cc5)CC4)cc3)O[C@@H]3O[C@]4(C)CC1[C@@]23OO4 |
| InChI | InChI=1S/C32H39FN2O6/c1-20-4-13-26-21(2)29(38-30-32(26)27(20)19-31(3,39-30)40-41-32)37-25-11-5-22(6-12-25)18-28(36)35-16-14-34(15-17-35)24-9-7-23(33)8-10-24/h5-12,20-21,26-27,29-30H,4,13-19H2,1-3H3/t20-,21-,26?,27?,29+,30-,31+,32+/m1/s1 |
| InChIKey | YVRIYVMNIYABBO-WTKSZSQMSA-N |
| XLogP | 4.91 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|