C28H41NO5 — CID 130279416
1-[[4-[[(3S,4R,5S,8R,9S,12R,14R,15S)-12-hydroperoxy-4,8,12,14-tetramethyl-2,13-dioxatetracyclo[7.4.2.01,15.05,15]pentadecan-3-yl]oxy]phenyl]methyl]pyrrolidine (PubChem CID 130279416) has the molecular formula C28H41NO5 and a molecular weight of 471.64 g/mol. Its IUPAC name is 1-[[4-[[(3S,4R,5S,8R,9S,12R,14R,15S)-12-hydroperoxy-4,8,12,14-tetramethyl-2,13-dioxatetracyclo[7.4.2.01,15.05,15]pentadecan-3-yl]oxy]phenyl]methyl]pyrrolidine.
| Compound Name | 1-[[4-[[(3S,4R,5S,8R,9S,12R,14R,15S)-12-hydroperoxy-4,8,12,14-tetramethyl-2,13-dioxatetracyclo[7.4.2.01,15.05,15]pentadecan-3-yl]oxy]phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 130279416 |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | 1-[[4-[[(3S,4R,5S,8R,9S,12R,14R,15S)-12-hydroperoxy-4,8,12,14-tetramethyl-2,13-dioxatetracyclo[7.4.2.01,15.05,15]pentadecan-3-yl]oxy]phenyl]methyl]pyrrolidine |
| SMILES | CC1C23O[C@H](Oc4ccc(CN5CCCC5)cc4)[C@H](C)[C@@H]4CC[C@@H](C)[C@H](CC[C@@](C)(OO)O2)[C@@]143 |
| InChI | InChI=1S/C28H41NO5/c1-18-7-12-24-19(2)25(31-22-10-8-21(9-11-22)17-29-15-5-6-16-29)32-28-20(3)27(24,28)23(18)13-14-26(4,33-28)34-30/h8-11,18-20,23-25,30H,5-7,12-17H2,1-4H3/t18-,19-,20?,23+,24+,25+,26-,27+,28?/m1/s1 |
| InChIKey | QMXQDPPSZOQQQJ-WTRXZUBZSA-N |
| XLogP | 5.66 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|