C19H30BrF3O5 — CID 162583666
(1S,3R,4R,5S,8R,9S,12R,14R)-3-(3-bromopropoxy)-4,8,12-trimethyl-3-(trifluoromethyl)-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol (PubChem CID 162583666) has the molecular formula C19H30BrF3O5 and a molecular weight of 475.34 g/mol. Its IUPAC name is (1S,3R,4R,5S,8R,9S,12R,14R)-3-(3-bromopropoxy)-4,8,12-trimethyl-3-(trifluoromethyl)-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol.
| Compound Name | (1S,3R,4R,5S,8R,9S,12R,14R)-3-(3-bromopropoxy)-4,8,12-trimethyl-3-(trifluoromethyl)-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol |
|---|---|
| PubChem CID | 162583666 |
| Molecular Formula | C19H30BrF3O5 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (1S,3R,4R,5S,8R,9S,12R,14R)-3-(3-bromopropoxy)-4,8,12-trimethyl-3-(trifluoromethyl)-2,13-dioxatricyclo[7.4.1.05,14]tetradecane-12,14-diol |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)[C@](OCCCBr)(C(F)(F)F)O[C@@H]3O[C@@](C)(O)CC[C@@H]1[C@]32O |
| InChI | InChI=1S/C19H30BrF3O5/c1-11-5-6-14-12(2)18(19(21,22)23,26-10-4-9-20)28-15-17(14,25)13(11)7-8-16(3,24)27-15/h11-15,24-25H,4-10H2,1-3H3/t11-,12-,13+,14+,15+,16-,17-,18-/m1/s1 |
| InChIKey | TVOOCHQFTNFTJJ-QOBNMGNYSA-N |
| XLogP | 3.95 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|