C15H24FeO5 — CID 59111509
(4R,9S,12S)-12,14-dihydroxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-one;iron (PubChem CID 59111509) has the molecular formula C15H24FeO5 and a molecular weight of 340.20 g/mol. Its IUPAC name is (4R,9S,12S)-12,14-dihydroxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-one;iron.
| Compound Name | (4R,9S,12S)-12,14-dihydroxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-one;iron |
|---|---|
| PubChem CID | 59111509 |
| Molecular Formula | C15H24FeO5 |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (4R,9S,12S)-12,14-dihydroxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-one;iron |
| SMILES | CC1CCC2[C@@H](C)C(=O)OC3O[C@](C)(O)CC[C@@H]1C32O.[Fe] |
| InChI | InChI=1S/C15H24O5.Fe/c1-8-4-5-11-9(2)12(16)19-13-15(11,18)10(8)6-7-14(3,17)20-13;/h8-11,13,17-18H,4-7H2,1-3H3;/t8?,9-,10+,11?,13?,14+,15?;/m1./s1 |
| InChIKey | VQAJFFAYAKDOKT-UAPVEIOBSA-N |
| XLogP | 1.42 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|