C15H24O3 — CID 101242877
(1R,4S,5S,8R,9S,13R)-13-hydroxy-4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]tridecan-3-one (PubChem CID 101242877) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,4S,5S,8R,9S,13R)-13-hydroxy-4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]tridecan-3-one.
| Compound Name | (1R,4S,5S,8R,9S,13R)-13-hydroxy-4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]tridecan-3-one |
|---|---|
| PubChem CID | 101242877 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,4S,5S,8R,9S,13R)-13-hydroxy-4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]tridecan-3-one |
| SMILES | CC1CC[C@H]2[C@H](C)CC[C@H]3[C@H](C)C(=O)O[C@H]1[C@@]23O |
| InChI | InChI=1S/C15H24O3/c1-8-4-7-12-10(3)14(16)18-13-9(2)5-6-11(8)15(12,13)17/h8-13,17H,4-7H2,1-3H3/t8-,9?,10+,11+,12+,13-,15-/m1/s1 |
| InChIKey | SIFCDGSBWGVSMJ-YZHBQLGDSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |