C15H22O5 — CID 129439070
(1R,2R,4S,7S,8R,11R,12S,13R)-2,7,11-trimethyl-3,5,14,15-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-6-one (PubChem CID 129439070) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1R,2R,4S,7S,8R,11R,12S,13R)-2,7,11-trimethyl-3,5,14,15-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-6-one.
| Compound Name | (1R,2R,4S,7S,8R,11R,12S,13R)-2,7,11-trimethyl-3,5,14,15-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-6-one |
|---|---|
| PubChem CID | 129439070 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1R,2R,4S,7S,8R,11R,12S,13R)-2,7,11-trimethyl-3,5,14,15-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-6-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@H](C)C(=O)O[C@@H]3O[C@H](C)[C@H]4C[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C15H22O5/c1-7-4-5-10-8(2)13(16)18-14-15(10)11(7)6-12(19-20-15)9(3)17-14/h7-12,14H,4-6H2,1-3H3/t7-,8+,9-,10-,11+,12-,14+,15+/m1/s1 |
| InChIKey | KDOVHMQJSIYPKZ-STZAWOOKSA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|