C20H33NO8S — CID 86576824
N-[(2R)-1,1-dihydroxy-3-sulfanylpropan-2-yl]acetamide;(5R,9R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 86576824) has the molecular formula C20H33NO8S and a molecular weight of 447.55 g/mol. Its IUPAC name is N-[(2R)-1,1-dihydroxy-3-sulfanylpropan-2-yl]acetamide;(5R,9R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | N-[(2R)-1,1-dihydroxy-3-sulfanylpropan-2-yl]acetamide;(5R,9R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 86576824 |
| Molecular Formula | C20H33NO8S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[(2R)-1,1-dihydroxy-3-sulfanylpropan-2-yl]acetamide;(5R,9R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | CC(=O)N[C@@H](CS)C(O)O.C[C@@H]1CCC2[C@@H](C)C(=O)OC3OC4(C)CCC1[C@]32OO4 |
| InChI | InChI=1S/C15H22O5.C5H11NO3S/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15;1-3(7)6-4(2-10)5(8)9/h8-11,13H,4-7H2,1-3H3;4-5,8-10H,2H2,1H3,(H,6,7)/t8-,9-,10?,11?,13?,14?,15-;4-/m10/s1 |
| InChIKey | KFMLEEMVKXQQOW-IBXKJPBTSA-N |
| XLogP | 1.13 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|