C16H22F2O4 — CID 59773637
(1S,4S,5R,8S,9R,12R)-10-(difluoromethylidene)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 59773637) has the molecular formula C16H22F2O4 and a molecular weight of 316.34 g/mol. Its IUPAC name is (1S,4S,5R,8S,9R,12R)-10-(difluoromethylidene)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,4S,5R,8S,9R,12R)-10-(difluoromethylidene)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 59773637 |
| Molecular Formula | C16H22F2O4 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1S,4S,5R,8S,9R,12R)-10-(difluoromethylidene)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=C(F)F)O[C@@H]3O[C@]4(C)CCC1C32OO4 |
| InChI | InChI=1S/C16H22F2O4/c1-8-4-5-11-9(2)12(13(17)18)19-14-16(11)10(8)6-7-15(3,20-14)21-22-16/h8-11,14H,4-7H2,1-3H3/t8-,9-,10?,11+,14-,15+,16?/m1/s1 |
| InChIKey | YJYOINOXGXHKGC-BKRQAOAXSA-N |
| XLogP | 3.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|