C17H25BrO4 — CID 11773175
(1S,4S,5R,8S,9R,10Z,12R,13R)-10-(1-bromoethylidene)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 11773175) has the molecular formula C17H25BrO4 and a molecular weight of 373.29 g/mol. Its IUPAC name is (1S,4S,5R,8S,9R,10Z,12R,13R)-10-(1-bromoethylidene)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,4S,5R,8S,9R,10Z,12R,13R)-10-(1-bromoethylidene)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 11773175 |
| Molecular Formula | C17H25BrO4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (1S,4S,5R,8S,9R,10Z,12R,13R)-10-(1-bromoethylidene)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C/C(Br)=C1/O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C17H25BrO4/c1-9-5-6-13-10(2)14(11(3)18)19-15-17(13)12(9)7-8-16(4,20-15)21-22-17/h9-10,12-13,15H,5-8H2,1-4H3/b14-11-/t9-,10-,12+,13+,15-,16+,17-/m1/s1 |
| InChIKey | LTLDGUBSVIOIRQ-BJAODKLWSA-N |
| XLogP | 4.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|