C16H26O3 — CID 126550629
(1S,5R,8S,9S,12S,13S)-1,5,9-trimethyl-14,15,16-trioxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 126550629) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (1S,5R,8S,9S,12S,13S)-1,5,9-trimethyl-14,15,16-trioxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,5R,8S,9S,12S,13S)-1,5,9-trimethyl-14,15,16-trioxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 126550629 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (1S,5R,8S,9S,12S,13S)-1,5,9-trimethyl-14,15,16-trioxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)CC[C@@H]3O[C@]4(C)CCC1[C@]32OO4 |
| InChI | InChI=1S/C16H26O3/c1-10-4-6-12-11(2)5-7-14-16(12)13(10)8-9-15(3,17-14)18-19-16/h10-14H,4-9H2,1-3H3/t10-,11+,12+,13?,14+,15+,16+/m1/s1 |
| InChIKey | POSDGQXISQVZLS-RCNGLSTGSA-N |
| XLogP | 3.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|