C21H32O6 — CID 73348370
(1S,4S,5R,8S,9S,12S,13R)-9-(4,4-dimethyl-3-oxopentyl)-1,5-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 73348370) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (1S,4S,5R,8S,9S,12S,13R)-9-(4,4-dimethyl-3-oxopentyl)-1,5-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1S,4S,5R,8S,9S,12S,13R)-9-(4,4-dimethyl-3-oxopentyl)-1,5-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 73348370 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (1S,4S,5R,8S,9S,12S,13R)-9-(4,4-dimethyl-3-oxopentyl)-1,5-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2[C@H](CCC(=O)C(C)(C)C)C(=O)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C21H32O6/c1-12-6-8-15-13(7-9-16(22)19(2,3)4)17(23)24-18-21(15)14(12)10-11-20(5,25-18)26-27-21/h12-15,18H,6-11H2,1-5H3/t12-,13+,14+,15+,18-,20+,21-/m1/s1 |
| InChIKey | BYOJDZPLHMDEDH-SSOBAWLVSA-N |
| XLogP | 3.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|