C21H25FO5 — CID 73354233
(1S,4S,5R,8S,9S,12S,13R)-9-[(4-fluorophenyl)methyl]-1,5-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 73354233) has the molecular formula C21H25FO5 and a molecular weight of 376.42 g/mol. Its IUPAC name is (1S,4S,5R,8S,9S,12S,13R)-9-[(4-fluorophenyl)methyl]-1,5-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1S,4S,5R,8S,9S,12S,13R)-9-[(4-fluorophenyl)methyl]-1,5-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 73354233 |
| Molecular Formula | C21H25FO5 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (1S,4S,5R,8S,9S,12S,13R)-9-[(4-fluorophenyl)methyl]-1,5-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2[C@H](Cc3ccc(F)cc3)C(=O)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C21H25FO5/c1-12-3-8-17-15(11-13-4-6-14(22)7-5-13)18(23)24-19-21(17)16(12)9-10-20(2,25-19)26-27-21/h4-7,12,15-17,19H,3,8-11H2,1-2H3/t12-,15+,16+,17+,19-,20+,21-/m1/s1 |
| InChIKey | OQXPJIZTHBMCMQ-UOVNHBKUSA-N |
| XLogP | 3.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|