C19H25NO7 — CID 45484324
1-[[(1S,4S,5R,8S,9S,12S,13R)-1,5-dimethyl-10-oxo-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-9-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 45484324) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-[[(1S,4S,5R,8S,9S,12S,13R)-1,5-dimethyl-10-oxo-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-9-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[(1S,4S,5R,8S,9S,12S,13R)-1,5-dimethyl-10-oxo-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-9-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 45484324 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[[(1S,4S,5R,8S,9S,12S,13R)-1,5-dimethyl-10-oxo-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-9-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](CN3C(=O)CCC3=O)C(=O)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C19H25NO7/c1-10-3-4-13-11(9-20-14(21)5-6-15(20)22)16(23)24-17-19(13)12(10)7-8-18(2,25-17)26-27-19/h10-13,17H,3-9H2,1-2H3/t10-,11-,12+,13+,17-,18+,19-/m1/s1 |
| InChIKey | KIMYENPKAGJYKX-DTFRLOPHSA-N |
| XLogP | 1.52 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|