C22H36O6 — CID 121356308
(1S,5R,9R,12R,13R)-10-(2-methoxycyclohexyl)oxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 121356308) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is (1S,5R,9R,12R,13R)-10-(2-methoxycyclohexyl)oxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,5R,9R,12R,13R)-10-(2-methoxycyclohexyl)oxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 121356308 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (1S,5R,9R,12R,13R)-10-(2-methoxycyclohexyl)oxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | COC1CCCCC1OC1O[C@@H]2O[C@]3(C)CCC4[C@H](C)CCC([C@H]1C)[C@]42OO3 |
| InChI | InChI=1S/C22H36O6/c1-13-9-10-16-14(2)19(24-18-8-6-5-7-17(18)23-4)25-20-22(16)15(13)11-12-21(3,26-20)27-28-22/h13-20H,5-12H2,1-4H3/t13-,14-,15?,16?,17?,18?,19?,20-,21+,22-/m1/s1 |
| InChIKey | QYIKXJIDCRMNOD-HGOPELFTSA-N |
| XLogP | 4.17 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|