C21H32O11 — CID 124934676
(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-[[(1R,4R,5R,8S,9S,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]oxane-2-carboxylic acid (PubChem CID 124934676) has the molecular formula C21H32O11 and a molecular weight of 460.48 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-[[(1R,4R,5R,8S,9S,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]oxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-[[(1R,4R,5R,8S,9S,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 124934676 |
| Molecular Formula | C21H32O11 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-[[(1R,4R,5R,8S,9S,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]oxane-2-carboxylic acid |
| SMILES | C[C@@H]1[C@@H](O[C@H]2O[C@@H](C(=O)O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]2O[C@@]3(C)CC[C@@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C21H32O11/c1-8-4-5-11-9(2)17(28-18-14(24)12(22)13(23)15(27-18)16(25)26)29-19-21(11)10(8)6-7-20(3,30-19)31-32-21/h8-15,17-19,22-24H,4-7H2,1-3H3,(H,25,26)/t8-,9+,10-,11+,12-,13-,14+,15-,17+,18-,19-,20-,21-/m1/s1 |
| InChIKey | ZPXMEOGHWWIMAF-DPRMHBOVSA-N |
| XLogP | 0.10 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|