C15H28O2 — CID 21140311
(1R,2S,4aR,5R,8S,8aS)-2,5-dimethyl-8-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalene-1,5-diol (PubChem CID 21140311) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (1R,2S,4aR,5R,8S,8aS)-2,5-dimethyl-8-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalene-1,5-diol.
| Compound Name | (1R,2S,4aR,5R,8S,8aS)-2,5-dimethyl-8-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalene-1,5-diol |
|---|---|
| PubChem CID | 21140311 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (1R,2S,4aR,5R,8S,8aS)-2,5-dimethyl-8-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalene-1,5-diol |
| SMILES | CC(C)[C@@H]1CC[C@@](C)(O)[C@@H]2CC[C@H](C)[C@@H](O)[C@H]21 |
| InChI | InChI=1S/C15H28O2/c1-9(2)11-7-8-15(4,17)12-6-5-10(3)14(16)13(11)12/h9-14,16-17H,5-8H2,1-4H3/t10-,11-,12+,13-,14+,15+/m0/s1 |
| InChIKey | OXXCIWLMJOPJNP-XDSHMYFISA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |