C19H28O — CID 163073662
(1R,2R,6S,7R,8S,11S,12S,14R)-6,14-dimethyl-9-methylidene-13-oxapentacyclo[9.3.2.16,8.02,7.012,14]heptadecane (PubChem CID 163073662) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1R,2R,6S,7R,8S,11S,12S,14R)-6,14-dimethyl-9-methylidene-13-oxapentacyclo[9.3.2.16,8.02,7.012,14]heptadecane.
| Compound Name | (1R,2R,6S,7R,8S,11S,12S,14R)-6,14-dimethyl-9-methylidene-13-oxapentacyclo[9.3.2.16,8.02,7.012,14]heptadecane |
|---|---|
| PubChem CID | 163073662 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1R,2R,6S,7R,8S,11S,12S,14R)-6,14-dimethyl-9-methylidene-13-oxapentacyclo[9.3.2.16,8.02,7.012,14]heptadecane |
| SMILES | C=C1C[C@@H]2CC[C@H]([C@@H]3CCC[C@@]4(C)C[C@H]1[C@@H]34)[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C19H28O/c1-11-9-12-6-7-15(19(3)17(12)20-19)13-5-4-8-18(2)10-14(11)16(13)18/h12-17H,1,4-10H2,2-3H3/t12-,13-,14+,15+,16+,17-,18-,19+/m0/s1 |
| InChIKey | NPJFPWLCIWUGQC-RYNUQQTHSA-N |
| XLogP | 4.57 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|