C27H36O3 — CID 571031
(8,11-dimethyl-4-methylidene-14-propan-2-yl-15-oxatetracyclo[9.4.0.01,14.05,9]pentadecan-2-yl) benzoate (PubChem CID 571031) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is (8,11-dimethyl-4-methylidene-14-propan-2-yl-15-oxatetracyclo[9.4.0.01,14.05,9]pentadecan-2-yl) benzoate.
| Compound Name | (8,11-dimethyl-4-methylidene-14-propan-2-yl-15-oxatetracyclo[9.4.0.01,14.05,9]pentadecan-2-yl) benzoate |
|---|---|
| PubChem CID | 571031 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (8,11-dimethyl-4-methylidene-14-propan-2-yl-15-oxatetracyclo[9.4.0.01,14.05,9]pentadecan-2-yl) benzoate |
| SMILES | C=C1CC(OC(=O)c2ccccc2)C23OC2(C(C)C)CCC3(C)CC2C(C)CCC12 |
| InChI | InChI=1S/C27H36O3/c1-17(2)26-14-13-25(5)16-22-18(3)11-12-21(22)19(4)15-23(27(25,26)30-26)29-24(28)20-9-7-6-8-10-20/h6-10,17-18,21-23H,4,11-16H2,1-3,5H3 |
| InChIKey | KZEABGFPMKHPKP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|