C19H20O4 — CID 139256636
[(1S,2S,5R)-5-methyl-4-methylidene-3-oxo-1-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-2-yl] benzoate (PubChem CID 139256636) has the molecular formula C19H20O4 and a molecular weight of 312.36 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-4-methylidene-3-oxo-1-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-2-yl] benzoate.
| Compound Name | [(1S,2S,5R)-5-methyl-4-methylidene-3-oxo-1-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-2-yl] benzoate |
|---|---|
| PubChem CID | 139256636 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-4-methylidene-3-oxo-1-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-2-yl] benzoate |
| SMILES | C=C1C(=O)[C@@H](OC(=O)c2ccccc2)[C@]2(C(C)C)C=C[C@@]1(C)O2 |
| InChI | InChI=1S/C19H20O4/c1-12(2)19-11-10-18(4,23-19)13(3)15(20)16(19)22-17(21)14-8-6-5-7-9-14/h5-12,16H,3H2,1-2,4H3/t16-,18-,19-/m1/s1 |
| InChIKey | WNVFLDPXJQFTFK-BHIYHBOVSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|