C16H22O3 — CID 118321450
(3-methoxy-2,2,4,4-tetramethylcyclobutyl) benzoate (PubChem CID 118321450) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (3-methoxy-2,2,4,4-tetramethylcyclobutyl) benzoate.
| Compound Name | (3-methoxy-2,2,4,4-tetramethylcyclobutyl) benzoate |
|---|---|
| PubChem CID | 118321450 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (3-methoxy-2,2,4,4-tetramethylcyclobutyl) benzoate |
| SMILES | COC1C(C)(C)C(OC(=O)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C16H22O3/c1-15(2)13(18-5)16(3,4)14(15)19-12(17)11-9-7-6-8-10-11/h6-10,13-14H,1-5H3 |
| InChIKey | CJDDQOCRJRKRKO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |