About (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate
(3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate (PubChem CID 10108166) has the molecular formula C17H20O4
and a molecular weight of 288.34 g/mol. Its IUPAC name is (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate.
Analyze (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate?
The IUPAC name of (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate (CID 10108166) is (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate.
What is the SMILES notation for (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate?
The canonical SMILES for (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate is COC1=C(C)CC(C)(C)C(OC(=O)c2ccccc2)C1=O.
What is the InChIKey of (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate?
The InChIKey is QELJNRNRBAWIHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O4/c1-11-10-17(2,3)15(13(18)14(11)20-4)21-16(19)12-8-6-5-7-9-12/h5-9,15H,10H2,1-4H3.
What are the key properties of (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate?
(3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate has a molecular weight of 288.34 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-4,6,6-trimethyl-2-oxocyclohex-3-en-1-yl) benzoate is sourced from PubChem (CID 10108166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).