C11H8O6 — CID 129396680
[(3S,4R)-4-hydroxy-2,5-dioxooxolan-3-yl] benzoate (PubChem CID 129396680) has the molecular formula C11H8O6 and a molecular weight of 236.18 g/mol. Its IUPAC name is [(3S,4R)-4-hydroxy-2,5-dioxooxolan-3-yl] benzoate.
| Compound Name | [(3S,4R)-4-hydroxy-2,5-dioxooxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 129396680 |
| Molecular Formula | C11H8O6 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | [(3S,4R)-4-hydroxy-2,5-dioxooxolan-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1C(=O)OC(=O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C11H8O6/c12-7-8(11(15)17-10(7)14)16-9(13)6-4-2-1-3-5-6/h1-5,7-8,12H/t7-,8+/m1/s1 |
| InChIKey | MLGJSRKGPQTQLB-SFYZADRCSA-N |
| XLogP | -0.34 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|