C26H20O8 — CID 58696778
[(2R,5S)-3,5-dibenzoyloxy-4-oxooxolan-2-yl]methyl benzoate (PubChem CID 58696778) has the molecular formula C26H20O8 and a molecular weight of 460.44 g/mol. Its IUPAC name is [(2R,5S)-3,5-dibenzoyloxy-4-oxooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5S)-3,5-dibenzoyloxy-4-oxooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 58696778 |
| Molecular Formula | C26H20O8 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [(2R,5S)-3,5-dibenzoyloxy-4-oxooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](OC(=O)c2ccccc2)C(=O)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20O8/c27-21-22(33-24(29)18-12-6-2-7-13-18)20(16-31-23(28)17-10-4-1-5-11-17)32-26(21)34-25(30)19-14-8-3-9-15-19/h1-15,20,22,26H,16H2/t20-,22?,26+/m1/s1 |
| InChIKey | XNTDXEVKPQUSSA-GVHMNUMSSA-N |
| XLogP | 3.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|