C18H24O5 — CID 23244395
[(2R,3S)-2-(acetyloxymethyl)-2,6,6-trimethyloxan-3-yl] benzoate (PubChem CID 23244395) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is [(2R,3S)-2-(acetyloxymethyl)-2,6,6-trimethyloxan-3-yl] benzoate.
| Compound Name | [(2R,3S)-2-(acetyloxymethyl)-2,6,6-trimethyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 23244395 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [(2R,3S)-2-(acetyloxymethyl)-2,6,6-trimethyloxan-3-yl] benzoate |
| SMILES | CC(=O)OC[C@@]1(C)OC(C)(C)CC[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24O5/c1-13(19)21-12-18(4)15(10-11-17(2,3)23-18)22-16(20)14-8-6-5-7-9-14/h5-9,15H,10-12H2,1-4H3/t15-,18+/m0/s1 |
| InChIKey | MIIBFJGKVYYWKI-MAUKXSAKSA-N |
| XLogP | 3.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |