C21H34N- — CID 163182452
[(1R,4S,4aR,7S,7aS,11aR)-4,7,10-trimethyl-1-prop-1-en-2-yl-1,2,3,4,4a,5,6,7a,8,9-decahydrobenzo[d]naphthalen-7-yl]-methylazanide (PubChem CID 163182452) has the molecular formula C21H34N- and a molecular weight of 300.51 g/mol. Its IUPAC name is [(1R,4S,4aR,7S,7aS,11aR)-4,7,10-trimethyl-1-prop-1-en-2-yl-1,2,3,4,4a,5,6,7a,8,9-decahydrobenzo[d]naphthalen-7-yl]-methylazanide.
| Compound Name | [(1R,4S,4aR,7S,7aS,11aR)-4,7,10-trimethyl-1-prop-1-en-2-yl-1,2,3,4,4a,5,6,7a,8,9-decahydrobenzo[d]naphthalen-7-yl]-methylazanide |
|---|---|
| PubChem CID | 163182452 |
| Molecular Formula | C21H34N- |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | [(1R,4S,4aR,7S,7aS,11aR)-4,7,10-trimethyl-1-prop-1-en-2-yl-1,2,3,4,4a,5,6,7a,8,9-decahydrobenzo[d]naphthalen-7-yl]-methylazanide |
| SMILES | C=C(C)[C@H]1CC[C@H](C)[C@H]2CC[C@](C)([N-]C)[C@H]3CCC(C)=C[C@@]123 |
| InChI | InChI=1S/C21H34N/c1-14(2)17-9-8-16(4)18-11-12-20(5,22-6)19-10-7-15(3)13-21(17,18)19/h13,16-19H,1,7-12H2,2-6H3/q-1/t16-,17+,18+,19+,20-,21+/m0/s1 |
| InChIKey | CLERGHMOVLSGBP-LDIYZUBKSA-N |
| XLogP | 6.12 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|