C20H32 — CID 140875681
(3R,5aR,10bR)-5a,8,10b-trimethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,9,10,10a-decahydrocyclohepta[e]indene (PubChem CID 140875681) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (3R,5aR,10bR)-5a,8,10b-trimethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,9,10,10a-decahydrocyclohepta[e]indene.
| Compound Name | (3R,5aR,10bR)-5a,8,10b-trimethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,9,10,10a-decahydrocyclohepta[e]indene |
|---|---|
| PubChem CID | 140875681 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (3R,5aR,10bR)-5a,8,10b-trimethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,9,10,10a-decahydrocyclohepta[e]indene |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)C1CC[C@]1(C)CC=C(C)CCC12 |
| InChI | InChI=1S/C20H32/c1-14(2)16-9-13-20(5)17(16)10-12-19(4)11-8-15(3)6-7-18(19)20/h8,16-18H,1,6-7,9-13H2,2-5H3/t16-,17?,18?,19-,20+/m0/s1 |
| InChIKey | FENGPFCAXVOXCJ-AABGDIPYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|