C25H40O — CID 162976577
[(1S,3Z,7Z,11R,12R,13R,16R)-1,4,16-trimethyl-13-prop-1-en-2-yl-8-tricyclo[9.7.0.012,16]octadeca-3,7-dienyl]methanol (PubChem CID 162976577) has the molecular formula C25H40O and a molecular weight of 356.59 g/mol. Its IUPAC name is [(1S,3Z,7Z,11R,12R,13R,16R)-1,4,16-trimethyl-13-prop-1-en-2-yl-8-tricyclo[9.7.0.012,16]octadeca-3,7-dienyl]methanol.
| Compound Name | [(1S,3Z,7Z,11R,12R,13R,16R)-1,4,16-trimethyl-13-prop-1-en-2-yl-8-tricyclo[9.7.0.012,16]octadeca-3,7-dienyl]methanol |
|---|---|
| PubChem CID | 162976577 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | [(1S,3Z,7Z,11R,12R,13R,16R)-1,4,16-trimethyl-13-prop-1-en-2-yl-8-tricyclo[9.7.0.012,16]octadeca-3,7-dienyl]methanol |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)CC[C@@]3(C)C/C=C(/C)CC/C=C(\CO)CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C25H40O/c1-18(2)21-12-14-25(5)16-15-24(4)13-11-19(3)7-6-8-20(17-26)9-10-22(24)23(21)25/h8,11,21-23,26H,1,6-7,9-10,12-17H2,2-5H3/b19-11-,20-8-/t21-,22+,23+,24+,25+/m0/s1 |
| InChIKey | DCNGLOIOZYSSRI-SAILUHJUSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|