C14H22O — CID 44517898
(4aR,8aS)-3,8,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalene-4a-carbaldehyde (PubChem CID 44517898) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (4aR,8aS)-3,8,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalene-4a-carbaldehyde.
| Compound Name | (4aR,8aS)-3,8,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalene-4a-carbaldehyde |
|---|---|
| PubChem CID | 44517898 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (4aR,8aS)-3,8,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalene-4a-carbaldehyde |
| SMILES | CC1=C[C@]2(C=O)CCCC(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C14H22O/c1-11-5-6-12-13(2,3)7-4-8-14(12,9-11)10-15/h9-10,12H,4-8H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | FLRYCFLHGYJHJS-JSGCOSHPSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|