C18H28O — CID 10978226
(3S,4aS,4bS,8aS)-3,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 10978226) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (3S,4aS,4bS,8aS)-3,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | (3S,4aS,4bS,8aS)-3,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 10978226 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (3S,4aS,4bS,8aS)-3,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | C[C@H]1C[C@H]2C(=CC1=O)CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C18H28O/c1-12-10-14-13(11-15(12)19)6-7-16-17(2,3)8-5-9-18(14,16)4/h11-12,14,16H,5-10H2,1-4H3/t12-,14-,16-,18+/m0/s1 |
| InChIKey | QXCOSAQVGPMBNR-WIRVQXDCSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |