C14H24O2 — CID 14433373
(4aS,8aS)-1-(hydroxymethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one (PubChem CID 14433373) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (4aS,8aS)-1-(hydroxymethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one.
| Compound Name | (4aS,8aS)-1-(hydroxymethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 14433373 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (4aS,8aS)-1-(hydroxymethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one |
| SMILES | CC1(C)CCC[C@]2(C)C(CO)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C14H24O2/c1-13(2)7-4-8-14(3)10(9-15)11(16)5-6-12(13)14/h10,12,15H,4-9H2,1-3H3/t10?,12-,14+/m0/s1 |
| InChIKey | WXBVWEGDNZGVON-BNPZDMCGSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |