C17H28O — CID 10977819
(1R,4aS,8aS)-1-but-3-enyl-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one (PubChem CID 10977819) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (1R,4aS,8aS)-1-but-3-enyl-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one.
| Compound Name | (1R,4aS,8aS)-1-but-3-enyl-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 10977819 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (1R,4aS,8aS)-1-but-3-enyl-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-one |
| SMILES | C=CCC[C@H]1C(=O)CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C17H28O/c1-5-6-8-13-14(18)9-10-15-16(2,3)11-7-12-17(13,15)4/h5,13,15H,1,6-12H2,2-4H3/t13-,15-,17+/m0/s1 |
| InChIKey | HCOXMIRFNUQSHY-JLJPHGGASA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|