C18H30O — CID 100923260
(4aS,7R,8R,8aS)-8-but-3-enyl-4,4,8a-trimethylspiro[2,3,4a,5,6,8-hexahydro-1H-naphthalene-7,2'-oxirane] (PubChem CID 100923260) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (4aS,7R,8R,8aS)-8-but-3-enyl-4,4,8a-trimethylspiro[2,3,4a,5,6,8-hexahydro-1H-naphthalene-7,2'-oxirane].
| Compound Name | (4aS,7R,8R,8aS)-8-but-3-enyl-4,4,8a-trimethylspiro[2,3,4a,5,6,8-hexahydro-1H-naphthalene-7,2'-oxirane] |
|---|---|
| PubChem CID | 100923260 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (4aS,7R,8R,8aS)-8-but-3-enyl-4,4,8a-trimethylspiro[2,3,4a,5,6,8-hexahydro-1H-naphthalene-7,2'-oxirane] |
| SMILES | C=CCC[C@H]1[C@]2(CC[C@H]3C(C)(C)CCC[C@@]31C)CO2 |
| InChI | InChI=1S/C18H30O/c1-5-6-8-15-17(4)11-7-10-16(2,3)14(17)9-12-18(15)13-19-18/h5,14-15H,1,6-13H2,2-4H3/t14-,15+,17-,18-/m0/s1 |
| InChIKey | CWEPNKIWXDUFCO-MVJTYMMSSA-N |
| XLogP | 4.96 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|