C19H30O — CID 11119291
(1R,4S,9S,10R,12R)-5,5,9-trimethyl-12-prop-2-enyl-13-oxatetracyclo[8.4.0.01,12.04,9]tetradecane (PubChem CID 11119291) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1R,4S,9S,10R,12R)-5,5,9-trimethyl-12-prop-2-enyl-13-oxatetracyclo[8.4.0.01,12.04,9]tetradecane.
| Compound Name | (1R,4S,9S,10R,12R)-5,5,9-trimethyl-12-prop-2-enyl-13-oxatetracyclo[8.4.0.01,12.04,9]tetradecane |
|---|---|
| PubChem CID | 11119291 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1R,4S,9S,10R,12R)-5,5,9-trimethyl-12-prop-2-enyl-13-oxatetracyclo[8.4.0.01,12.04,9]tetradecane |
| SMILES | C=CC[C@@]12C[C@@H]3[C@@]4(C)CCCC(C)(C)[C@@H]4CC[C@]31CO2 |
| InChI | InChI=1S/C19H30O/c1-5-8-19-12-15-17(4)10-6-9-16(2,3)14(17)7-11-18(15,19)13-20-19/h5,14-15H,1,6-13H2,2-4H3/t14-,15+,17-,18-,19+/m0/s1 |
| InChIKey | SKEASXOXEHFRLA-HAYURNKSSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|