C17H30 — CID 57219615
(1S,2S,8aR)-2,5,5,8a-tetramethyl-1-prop-2-enyl-1,2,3,4,4a,6,7,8-octahydronaphthalene (PubChem CID 57219615) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is (1S,2S,8aR)-2,5,5,8a-tetramethyl-1-prop-2-enyl-1,2,3,4,4a,6,7,8-octahydronaphthalene.
| Compound Name | (1S,2S,8aR)-2,5,5,8a-tetramethyl-1-prop-2-enyl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 57219615 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | (1S,2S,8aR)-2,5,5,8a-tetramethyl-1-prop-2-enyl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES | C=CC[C@H]1[C@@H](C)CCC2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C17H30/c1-6-8-14-13(2)9-10-15-16(3,4)11-7-12-17(14,15)5/h6,13-15H,1,7-12H2,2-5H3/t13-,14-,15?,17+/m0/s1 |
| InChIKey | MJPAHYSOWNPDKH-IAPOVROPSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|