C22H38O2 — CID 102471984
(1R,2S,3S,4aS,4bS,8aS,10aS)-2-(hydroxymethyl)-4b,8,8,10a-tetramethyl-1-prop-2-enyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-3-ol (PubChem CID 102471984) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is (1R,2S,3S,4aS,4bS,8aS,10aS)-2-(hydroxymethyl)-4b,8,8,10a-tetramethyl-1-prop-2-enyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-3-ol.
| Compound Name | (1R,2S,3S,4aS,4bS,8aS,10aS)-2-(hydroxymethyl)-4b,8,8,10a-tetramethyl-1-prop-2-enyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-3-ol |
|---|---|
| PubChem CID | 102471984 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | (1R,2S,3S,4aS,4bS,8aS,10aS)-2-(hydroxymethyl)-4b,8,8,10a-tetramethyl-1-prop-2-enyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-3-ol |
| SMILES | C=CC[C@@H]1[C@@H](CO)[C@@H](O)C[C@H]2[C@@]1(C)CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C22H38O2/c1-6-8-16-15(14-23)17(24)13-19-21(16,4)12-9-18-20(2,3)10-7-11-22(18,19)5/h6,15-19,23-24H,1,7-14H2,2-5H3/t15-,16-,17+,18+,19+,21+,22+/m1/s1 |
| InChIKey | AZPOUSJJWQIBBG-JCNKSZRGSA-N |
| XLogP | 4.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|