C20H34O — CID 91747131
(3S,4R,4aS)-3,4a,8,8-tetramethyl-4-(3-methylidenepent-4-enyl)-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-ol (PubChem CID 91747131) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (3S,4R,4aS)-3,4a,8,8-tetramethyl-4-(3-methylidenepent-4-enyl)-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-ol.
| Compound Name | (3S,4R,4aS)-3,4a,8,8-tetramethyl-4-(3-methylidenepent-4-enyl)-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 91747131 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (3S,4R,4aS)-3,4a,8,8-tetramethyl-4-(3-methylidenepent-4-enyl)-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-ol |
| SMILES | C=CC(=C)CC[C@@H]1[C@H](C)C(O)CC2C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H34O/c1-7-14(2)9-10-16-15(3)17(21)13-18-19(4,5)11-8-12-20(16,18)6/h7,15-18,21H,1-2,8-13H2,3-6H3/t15-,16+,17?,18?,20-/m0/s1 |
| InChIKey | QOHASKVMQCQLLB-PELKOZEMSA-N |
| XLogP | 5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|