C11H20O — CID 89331828
(7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol (PubChem CID 89331828) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol.
| Compound Name | (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol |
|---|---|
| PubChem CID | 89331828 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol |
| SMILES | CC1(C)CCCC2(C)C1C[C@H]2O |
| InChI | InChI=1S/C11H20O/c1-10(2)5-4-6-11(3)8(10)7-9(11)12/h8-9,12H,4-7H2,1-3H3/t8?,9-,11?/m1/s1 |
| InChIKey | KFMDORNHMNZCHA-INWMGODYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |