About (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol
(7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol (PubChem CID 89331828) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol.
Molecular Properties
| Compound Name | (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol |
| PubChem CID | 89331828 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol |
| SMILES | CC1(C)CCCC2(C)C1C[C@H]2O |
| InChI | InChI=1S/C11H20O/c1-10(2)5-4-6-11(3)8(10)7-9(11)12/h8-9,12H,4-7H2,1-3H3/t8?,9-,11?/m1/s1 |
| InChIKey | KFMDORNHMNZCHA-INWMGODYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol?
The IUPAC name of (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol (CID 89331828) is (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol.
What is the SMILES notation for (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol?
The canonical SMILES for (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol is CC1(C)CCCC2(C)C1C[C@H]2O.
What is the InChIKey of (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol?
The InChIKey is KFMDORNHMNZCHA-INWMGODYSA-N. The full InChI is InChI=1S/C11H20O/c1-10(2)5-4-6-11(3)8(10)7-9(11)12/h8-9,12H,4-7H2,1-3H3/t8?,9-,11?/m1/s1.
What are the key properties of (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol?
(7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol has a molecular weight of 168.28 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-2,2,6-trimethylbicyclo[4.2.0]octan-7-ol is sourced from PubChem (CID 89331828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).