C22H36O6 — CID 16655649
(4aS,6R,6aS,7aR,8R,10S,11R,11aR,12aR,12bS)-4,4,6a,12b-tetramethyl-9-methylidene-1,2,3,4a,5,6,7a,8,10,11,12,12a-dodecahydronaphtho[2,1-b]chromene-6,8,10,11,11a-pentol (PubChem CID 16655649) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is (4aS,6R,6aS,7aR,8R,10S,11R,11aR,12aR,12bS)-4,4,6a,12b-tetramethyl-9-methylidene-1,2,3,4a,5,6,7a,8,10,11,12,12a-dodecahydronaphtho[2,1-b]chromene-6,8,10,11,11a-pentol.
| Compound Name | (4aS,6R,6aS,7aR,8R,10S,11R,11aR,12aR,12bS)-4,4,6a,12b-tetramethyl-9-methylidene-1,2,3,4a,5,6,7a,8,10,11,12,12a-dodecahydronaphtho[2,1-b]chromene-6,8,10,11,11a-pentol |
|---|---|
| PubChem CID | 16655649 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (4aS,6R,6aS,7aR,8R,10S,11R,11aR,12aR,12bS)-4,4,6a,12b-tetramethyl-9-methylidene-1,2,3,4a,5,6,7a,8,10,11,12,12a-dodecahydronaphtho[2,1-b]chromene-6,8,10,11,11a-pentol |
| SMILES | C=C1[C@@H](O)[C@H]2O[C@]3(C)[C@H](O)C[C@H]4C(C)(C)CCC[C@]4(C)[C@H]3C[C@@]2(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H36O6/c1-11-15(24)17(26)22(27)10-13-20(4)8-6-7-19(2,3)12(20)9-14(23)21(13,5)28-18(22)16(11)25/h12-18,23-27H,1,6-10H2,2-5H3/t12-,13+,14+,15-,16+,17+,18+,20-,21-,22+/m0/s1 |
| InChIKey | PSCOWRGKNBHDKG-QEQGRUKNSA-N |
| XLogP | 1.13 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|