C13H22O — CID 130977926
(1S,3aR,7aS)-4,4,7a-trimethyl-2-methylidene-1,3,3a,5,6,7-hexahydroinden-1-ol (PubChem CID 130977926) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (1S,3aR,7aS)-4,4,7a-trimethyl-2-methylidene-1,3,3a,5,6,7-hexahydroinden-1-ol.
| Compound Name | (1S,3aR,7aS)-4,4,7a-trimethyl-2-methylidene-1,3,3a,5,6,7-hexahydroinden-1-ol |
|---|---|
| PubChem CID | 130977926 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (1S,3aR,7aS)-4,4,7a-trimethyl-2-methylidene-1,3,3a,5,6,7-hexahydroinden-1-ol |
| SMILES | C=C1C[C@@H]2C(C)(C)CCC[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C13H22O/c1-9-8-10-12(2,3)6-5-7-13(10,4)11(9)14/h10-11,14H,1,5-8H2,2-4H3/t10-,11+,13+/m1/s1 |
| InChIKey | MANGAGFYNQINPX-MDZLAQPJSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|