C13H22O2 — CID 15511691
(1R,2S,3S,4S,5R)-5-(hydroxymethyl)-4-methyl-3-prop-2-enylbicyclo[2.2.2]octan-2-ol (PubChem CID 15511691) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R)-5-(hydroxymethyl)-4-methyl-3-prop-2-enylbicyclo[2.2.2]octan-2-ol.
| Compound Name | (1R,2S,3S,4S,5R)-5-(hydroxymethyl)-4-methyl-3-prop-2-enylbicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 15511691 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (1R,2S,3S,4S,5R)-5-(hydroxymethyl)-4-methyl-3-prop-2-enylbicyclo[2.2.2]octan-2-ol |
| SMILES | C=CC[C@@H]1[C@@H](O)[C@@H]2CC[C@@]1(C)[C@H](CO)C2 |
| InChI | InChI=1S/C13H22O2/c1-3-4-11-12(15)9-5-6-13(11,2)10(7-9)8-14/h3,9-12,14-15H,1,4-8H2,2H3/t9-,10+,11-,12+,13+/m1/s1 |
| InChIKey | YCXYDLQYFGMDBD-FHUSYTEZSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|