C7H14O — CID 129404662
[(1S)-2,2-dimethylcyclobutyl]methanol (PubChem CID 129404662) has the molecular formula C7H14O and a molecular weight of 114.19 g/mol. Its IUPAC name is [(1S)-2,2-dimethylcyclobutyl]methanol.
| Compound Name | [(1S)-2,2-dimethylcyclobutyl]methanol |
|---|---|
| PubChem CID | 129404662 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | [(1S)-2,2-dimethylcyclobutyl]methanol |
| SMILES | CC1(C)CC[C@@H]1CO |
| InChI | InChI=1S/C7H14O/c1-7(2)4-3-6(7)5-8/h6,8H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | KDDFEANSQQUNGO-ZCFIWIBFSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |