C9H19NO — CID 117025806
(1,4,4-trimethylpiperidin-3-yl)methanol (PubChem CID 117025806) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (1,4,4-trimethylpiperidin-3-yl)methanol.
| Compound Name | (1,4,4-trimethylpiperidin-3-yl)methanol |
|---|---|
| PubChem CID | 117025806 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (1,4,4-trimethylpiperidin-3-yl)methanol |
| SMILES | CN1CCC(C)(C)C(CO)C1 |
| InChI | InChI=1S/C9H19NO/c1-9(2)4-5-10(3)6-8(9)7-11/h8,11H,4-7H2,1-3H3 |
| InChIKey | IACZFESSKBNCIR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |